 
														
													
Mobile/Wechat/WhatsApp: +447394406898
Email:wibson.aris@gmail.com
CasNo: 78491-02-8
Molecular Formula: C8H14N4O7
Appearance: white powder
| Flammability and Explosibility | Nonflammable | 
| Contact allergens | Diazolidinyl urea, a formaldehyde releaser, is contained mainly in cosmetics and toiletries and can be found in barrier creams. | 
InChI:InChI=1/C4H10N4O/c5-4(9)7-8-2-1-6-3-8/h6H,1-3H2,(H3,5,7,9)
The present invention is a compound cont...
The present invention relates to an anti...
The present invention relates to a rinse...
The present invention relates to a rinse...


diazolidinyl urea
| Conditions | Yield | 
|---|---|
|  | |
|  | |
|  | |
|  | |
|  | |
|  | 

diazolidinyl urea


formaldehyd
| Conditions | Yield | 
|---|---|
| In   aq. phosphate buffer; water-d2; acetonitrile;   at 37 ℃; for 0.5h; pH=7.4; Sealed tube;  | 

formaldehyd
